C12H17F2NO — CID 103585345
N-(1-ethoxypropan-2-yl)-2,5-difluoro-4-methylaniline (PubChem CID 103585345) has the molecular formula C12H17F2NO and a molecular weight of 229.27 g/mol. Its IUPAC name is N-(1-ethoxypropan-2-yl)-2,5-difluoro-4-methylaniline.
| Compound Name | N-(1-ethoxypropan-2-yl)-2,5-difluoro-4-methylaniline |
|---|---|
| PubChem CID | 103585345 |
| Molecular Formula | C12H17F2NO |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-(1-ethoxypropan-2-yl)-2,5-difluoro-4-methylaniline |
| SMILES | CCOCC(C)Nc1cc(F)c(C)cc1F |
| InChI | InChI=1S/C12H17F2NO/c1-4-16-7-9(3)15-12-6-10(13)8(2)5-11(12)14/h5-6,9,15H,4,7H2,1-3H3 |
| InChIKey | ZCRYAYKETSUXPR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |