C12H14F2N2 — CID 103585766
3-(2,5-difluoro-4-methylanilino)pentanenitrile (PubChem CID 103585766) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-methylanilino)pentanenitrile.
| Compound Name | 3-(2,5-difluoro-4-methylanilino)pentanenitrile |
|---|---|
| PubChem CID | 103585766 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-(2,5-difluoro-4-methylanilino)pentanenitrile |
| SMILES | CCC(CC#N)Nc1cc(F)c(C)cc1F |
| InChI | InChI=1S/C12H14F2N2/c1-3-9(4-5-15)16-12-7-10(13)8(2)6-11(12)14/h6-7,9,16H,3-4H2,1-2H3 |
| InChIKey | LLUMRPPJHBJMRX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |