C11H11Cl3N2 — CID 43368249
3-(2,4,5-trichloroanilino)pentanenitrile (PubChem CID 43368249) has the molecular formula C11H11Cl3N2 and a molecular weight of 277.58 g/mol. Its IUPAC name is 3-(2,4,5-trichloroanilino)pentanenitrile.
| Compound Name | 3-(2,4,5-trichloroanilino)pentanenitrile |
|---|---|
| PubChem CID | 43368249 |
| Molecular Formula | C11H11Cl3N2 |
| Molecular Weight | 277.58 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | 3-(2,4,5-trichloroanilino)pentanenitrile |
| SMILES | CCC(CC#N)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl3N2/c1-2-7(3-4-15)16-11-6-9(13)8(12)5-10(11)14/h5-7,16H,2-3H2,1H3 |
| InChIKey | GAPSHGFCVPAXRO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|