C12H12ClF3N2 — CID 116699483
3-[3-chloro-5-(trifluoromethyl)anilino]pentanenitrile (PubChem CID 116699483) has the molecular formula C12H12ClF3N2 and a molecular weight of 276.69 g/mol. Its IUPAC name is 3-[3-chloro-5-(trifluoromethyl)anilino]pentanenitrile.
| Compound Name | 3-[3-chloro-5-(trifluoromethyl)anilino]pentanenitrile |
|---|---|
| PubChem CID | 116699483 |
| Molecular Formula | C12H12ClF3N2 |
| Molecular Weight | 276.69 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-[3-chloro-5-(trifluoromethyl)anilino]pentanenitrile |
| SMILES | CCC(CC#N)Nc1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3N2/c1-2-10(3-4-17)18-11-6-8(12(14,15)16)5-9(13)7-11/h5-7,10,18H,2-3H2,1H3 |
| InChIKey | UHHLPUFVKOVYHT-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |