C18H36O3Si — CID 10359177
(2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]oxolane-2-carbaldehyde (PubChem CID 10359177) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]oxolane-2-carbaldehyde.
| Compound Name | (2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 10359177 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (2S,5R)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyheptyl]oxolane-2-carbaldehyde |
| SMILES | CCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@@H](C=O)O1 |
| InChI | InChI=1S/C18H36O3Si/c1-7-8-9-10-11-17(16-13-12-15(14-19)20-16)21-22(5,6)18(2,3)4/h14-17H,7-13H2,1-6H3/t15-,16+,17+/m0/s1 |
| InChIKey | HIIPMHPBHGXGAS-GVDBMIGSSA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|