C17H32O4Si — CID 10404263
(2R,4aR,6R,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-2-carbaldehyde (PubChem CID 10404263) has the molecular formula C17H32O4Si and a molecular weight of 328.52 g/mol. Its IUPAC name is (2R,4aR,6R,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-2-carbaldehyde.
| Compound Name | (2R,4aR,6R,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-2-carbaldehyde |
|---|---|
| PubChem CID | 10404263 |
| Molecular Formula | C17H32O4Si |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (2R,4aR,6R,9aS)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCC[C@@H]2O[C@@H](C=O)CC[C@H]2O1 |
| InChI | InChI=1S/C17H32O4Si/c1-17(2,3)22(4,5)19-12-14-7-6-8-15-16(21-14)10-9-13(11-18)20-15/h11,13-16H,6-10,12H2,1-5H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | DLUWYAQDKITHAO-LVQVYYBASA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|