C26H50O4Si — CID 11316994
(2R,5S)-5-[(2S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolane-2-carbaldehyde (PubChem CID 11316994) has the molecular formula C26H50O4Si and a molecular weight of 454.77 g/mol. Its IUPAC name is (2R,5S)-5-[(2S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolane-2-carbaldehyde.
| Compound Name | (2R,5S)-5-[(2S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 11316994 |
| Molecular Formula | C26H50O4Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.35 |
| IUPAC Name | (2R,5S)-5-[(2S,5R)-5-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]oxolan-2-yl]oxolane-2-carbaldehyde |
| SMILES | CCCCCCCCCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@@H]([C@@H]2CC[C@H](C=O)O2)O1 |
| InChI | InChI=1S/C26H50O4Si/c1-7-8-9-10-11-12-13-14-15-25(30-31(5,6)26(2,3)4)24-19-18-23(29-24)22-17-16-21(20-27)28-22/h20-25H,7-19H2,1-6H3/t21-,22+,23+,24-,25+/m1/s1 |
| InChIKey | MKVOLPZJPIQJNH-MQZWXTIWSA-N |
| XLogP | 7.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|