C15H17FN2O2S — CID 103592589
2-[5-fluoro-6-methyl-1-[(E)-pent-3-enyl]benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 103592589) has the molecular formula C15H17FN2O2S and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[5-fluoro-6-methyl-1-[(E)-pent-3-enyl]benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-fluoro-6-methyl-1-[(E)-pent-3-enyl]benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 103592589 |
| Molecular Formula | C15H17FN2O2S |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 2-[5-fluoro-6-methyl-1-[(E)-pent-3-enyl]benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | C/C=C/CCn1c(SCC(=O)O)nc2cc(F)c(C)cc21 |
| InChI | InChI=1S/C15H17FN2O2S/c1-3-4-5-6-18-13-7-10(2)11(16)8-12(13)17-15(18)21-9-14(19)20/h3-4,7-8H,5-6,9H2,1-2H3,(H,19,20)/b4-3+ |
| InChIKey | PCWAZRBHUVDXTJ-ONEGZZNKSA-N |
| XLogP | 3.63 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|