C13H15BrFN3O2S — CID 66086295
2-[5-bromo-1-[2-(dimethylamino)ethyl]-6-fluorobenzimidazol-2-yl]sulfanylacetic acid (PubChem CID 66086295) has the molecular formula C13H15BrFN3O2S and a molecular weight of 376.25 g/mol. Its IUPAC name is 2-[5-bromo-1-[2-(dimethylamino)ethyl]-6-fluorobenzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-bromo-1-[2-(dimethylamino)ethyl]-6-fluorobenzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 66086295 |
| Molecular Formula | C13H15BrFN3O2S |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-[5-bromo-1-[2-(dimethylamino)ethyl]-6-fluorobenzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CN(C)CCn1c(SCC(=O)O)nc2cc(Br)c(F)cc21 |
| InChI | InChI=1S/C13H15BrFN3O2S/c1-17(2)3-4-18-11-6-9(15)8(14)5-10(11)16-13(18)21-7-12(19)20/h5-6H,3-4,7H2,1-2H3,(H,19,20) |
| InChIKey | UZIWIJJRMWHTGU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |