C14H17FN2O2S2 — CID 103592581
2-[5-fluoro-6-methyl-1-(3-methylsulfanylpropyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 103592581) has the molecular formula C14H17FN2O2S2 and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-[5-fluoro-6-methyl-1-(3-methylsulfanylpropyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-fluoro-6-methyl-1-(3-methylsulfanylpropyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 103592581 |
| Molecular Formula | C14H17FN2O2S2 |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-[5-fluoro-6-methyl-1-(3-methylsulfanylpropyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | CSCCCn1c(SCC(=O)O)nc2cc(F)c(C)cc21 |
| InChI | InChI=1S/C14H17FN2O2S2/c1-9-6-12-11(7-10(9)15)16-14(21-8-13(18)19)17(12)4-3-5-20-2/h6-7H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | FDGQHMLQJINZTH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|