C12H15ClFN3 — CID 103593916
2-(1-chloroethyl)-5-fluoro-N,N,6-trimethylbenzimidazol-1-amine (PubChem CID 103593916) has the molecular formula C12H15ClFN3 and a molecular weight of 255.72 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-fluoro-N,N,6-trimethylbenzimidazol-1-amine.
| Compound Name | 2-(1-chloroethyl)-5-fluoro-N,N,6-trimethylbenzimidazol-1-amine |
|---|---|
| PubChem CID | 103593916 |
| Molecular Formula | C12H15ClFN3 |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(1-chloroethyl)-5-fluoro-N,N,6-trimethylbenzimidazol-1-amine |
| SMILES | Cc1cc2c(cc1F)nc(C(C)Cl)n2N(C)C |
| InChI | InChI=1S/C12H15ClFN3/c1-7-5-11-10(6-9(7)14)15-12(8(2)13)17(11)16(3)4/h5-6,8H,1-4H3 |
| InChIKey | CXVKMLDTNXCOQP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|