C12H16ClN3 — CID 83017764
2-(1-chloroethyl)-N,N,5-trimethylbenzimidazol-1-amine (PubChem CID 83017764) has the molecular formula C12H16ClN3 and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-(1-chloroethyl)-N,N,5-trimethylbenzimidazol-1-amine.
| Compound Name | 2-(1-chloroethyl)-N,N,5-trimethylbenzimidazol-1-amine |
|---|---|
| PubChem CID | 83017764 |
| Molecular Formula | C12H16ClN3 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(1-chloroethyl)-N,N,5-trimethylbenzimidazol-1-amine |
| SMILES | Cc1ccc2c(c1)nc(C(C)Cl)n2N(C)C |
| InChI | InChI=1S/C12H16ClN3/c1-8-5-6-11-10(7-8)14-12(9(2)13)16(11)15(3)4/h5-7,9H,1-4H3 |
| InChIKey | DMYMWPUVUIMXTQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|