C14H13ClF4N2 — CID 106216892
2-(1-chloroethyl)-5-fluoro-6-methyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole (PubChem CID 106216892) has the molecular formula C14H13ClF4N2 and a molecular weight of 320.72 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-fluoro-6-methyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-fluoro-6-methyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole |
|---|---|
| PubChem CID | 106216892 |
| Molecular Formula | C14H13ClF4N2 |
| Molecular Weight | 320.72 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-(1-chloroethyl)-5-fluoro-6-methyl-1-[1-(trifluoromethyl)cyclopropyl]benzimidazole |
| SMILES | Cc1cc2c(cc1F)nc(C(C)Cl)n2C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H13ClF4N2/c1-7-5-11-10(6-9(7)16)20-12(8(2)15)21(11)13(3-4-13)14(17,18)19/h5-6,8H,3-4H2,1-2H3 |
| InChIKey | QCTYPWCYYRKIRY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|