C17H15N3O3S — CID 103598020
2-cyano-N-(4-methoxyphenyl)-5-(2-methyl-1,3-thiazol-4-yl)-3-oxopent-4-enamide (PubChem CID 103598020) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-cyano-N-(4-methoxyphenyl)-5-(2-methyl-1,3-thiazol-4-yl)-3-oxopent-4-enamide.
| Compound Name | 2-cyano-N-(4-methoxyphenyl)-5-(2-methyl-1,3-thiazol-4-yl)-3-oxopent-4-enamide |
|---|---|
| PubChem CID | 103598020 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 2-cyano-N-(4-methoxyphenyl)-5-(2-methyl-1,3-thiazol-4-yl)-3-oxopent-4-enamide |
| SMILES | COc1ccc(NC(=O)C(C#N)C(=O)C=Cc2csc(C)n2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c1-11-19-13(10-24-11)5-8-16(21)15(9-18)17(22)20-12-3-6-14(23-2)7-4-12/h3-8,10,15H,1-2H3,(H,20,22) |
| InChIKey | WCTFYZOPNGZGOH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|