C17H20N4O4S — CID 103598328
N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclobutyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 103598328) has the molecular formula C17H20N4O4S and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclobutyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclobutyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 103598328 |
| Molecular Formula | C17H20N4O4S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclobutyl]-3-[4-(methylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1ccc(C=CC(=O)NC2(c3noc(C)n3)CCC2)cc1 |
| InChI | InChI=1S/C17H20N4O4S/c1-12-19-16(21-25-12)17(10-3-11-17)20-15(22)9-6-13-4-7-14(8-5-13)26(23,24)18-2/h4-9,18H,3,10-11H2,1-2H3,(H,20,22) |
| InChIKey | HOYZZCGETLJNBM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|