C19H20ClN3O4 — CID 47018887
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]prop-2-enamide (PubChem CID 47018887) has the molecular formula C19H20ClN3O4 and a molecular weight of 389.84 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 47018887 |
| Molecular Formula | C19H20ClN3O4 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclohexyl]prop-2-enamide |
| SMILES | Cc1nc(C2(NC(=O)/C=C/c3cc(Cl)c4c(c3)OCO4)CCCCC2)no1 |
| InChI | InChI=1S/C19H20ClN3O4/c1-12-21-18(23-27-12)19(7-3-2-4-8-19)22-16(24)6-5-13-9-14(20)17-15(10-13)25-11-26-17/h5-6,9-10H,2-4,7-8,11H2,1H3,(H,22,24)/b6-5+ |
| InChIKey | OWTJCBSQKULBTO-AATRIKPKSA-N |
| XLogP | 3.75 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|