C21H28N4O5S — CID 55980856
3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]prop-2-enamide (PubChem CID 55980856) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]prop-2-enamide.
| Compound Name | 3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]prop-2-enamide |
|---|---|
| PubChem CID | 55980856 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 3-[4-methoxy-3-(methylsulfamoyl)phenyl]-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cycloheptyl]prop-2-enamide |
| SMILES | CNS(=O)(=O)c1cc(C=CC(=O)NC2(c3noc(C)n3)CCCCCC2)ccc1OC |
| InChI | InChI=1S/C21H28N4O5S/c1-15-23-20(25-30-15)21(12-6-4-5-7-13-21)24-19(26)11-9-16-8-10-17(29-3)18(14-16)31(27,28)22-2/h8-11,14,22H,4-7,12-13H2,1-3H3,(H,24,26) |
| InChIKey | QNKVRUBRNJWJGS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|