C15H16O9 — CID 10359882
methyl (1R,4R,5S,6R)-4-(3-methoxy-3-oxoprop-1-en-2-yl)oxy-5-(2-oxopropanoyloxy)-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylate (PubChem CID 10359882) has the molecular formula C15H16O9 and a molecular weight of 340.28 g/mol. Its IUPAC name is methyl (1R,4R,5S,6R)-4-(3-methoxy-3-oxoprop-1-en-2-yl)oxy-5-(2-oxopropanoyloxy)-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylate.
| Compound Name | methyl (1R,4R,5S,6R)-4-(3-methoxy-3-oxoprop-1-en-2-yl)oxy-5-(2-oxopropanoyloxy)-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10359882 |
| Molecular Formula | C15H16O9 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl (1R,4R,5S,6R)-4-(3-methoxy-3-oxoprop-1-en-2-yl)oxy-5-(2-oxopropanoyloxy)-7-oxabicyclo[4.1.0]hept-2-ene-2-carboxylate |
| SMILES | C=C(O[C@@H]1C=C(C(=O)OC)[C@H]2O[C@H]2[C@H]1OC(=O)C(C)=O)C(=O)OC |
| InChI | InChI=1S/C15H16O9/c1-6(16)13(17)24-11-9(22-7(2)14(18)20-3)5-8(15(19)21-4)10-12(11)23-10/h5,9-12H,2H2,1,3-4H3/t9-,10-,11+,12-/m1/s1 |
| InChIKey | LGLLWDOFCFYNTR-WISYIIOYSA-N |
| XLogP | -0.56 |
| TPSA | 117.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|