C10H15F2NO — CID 103602571
N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroacetamide (PubChem CID 103602571) has the molecular formula C10H15F2NO and a molecular weight of 203.23 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 103602571 |
| Molecular Formula | C10H15F2NO |
| Molecular Weight | 203.23 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroacetamide |
| SMILES | O=C(NCCC1=CCCCC1)C(F)F |
| InChI | InChI=1S/C10H15F2NO/c11-9(12)10(14)13-7-6-8-4-2-1-3-5-8/h4,9H,1-3,5-7H2,(H,13,14) |
| InChIKey | XEWSTJRPUUJPJK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|