C20H27N3O3 — CID 10360985
ethyl 5-[(E)-(3-imidazol-1-yl-4-phenylbutan-2-ylidene)amino]oxypentanoate (PubChem CID 10360985) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is ethyl 5-[(E)-(3-imidazol-1-yl-4-phenylbutan-2-ylidene)amino]oxypentanoate.
| Compound Name | ethyl 5-[(E)-(3-imidazol-1-yl-4-phenylbutan-2-ylidene)amino]oxypentanoate |
|---|---|
| PubChem CID | 10360985 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | ethyl 5-[(E)-(3-imidazol-1-yl-4-phenylbutan-2-ylidene)amino]oxypentanoate |
| SMILES | CCOC(=O)CCCCO/N=C(\C)C(Cc1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C20H27N3O3/c1-3-25-20(24)11-7-8-14-26-22-17(2)19(23-13-12-21-16-23)15-18-9-5-4-6-10-18/h4-6,9-10,12-13,16,19H,3,7-8,11,14-15H2,1-2H3/b22-17+ |
| InChIKey | RIYOXJSCSMCSGD-OQKWZONESA-N |
| XLogP | 3.79 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|