C25H29N3O3 — CID 10982669
ethyl 5-[(E)-[(2R)-2-imidazol-1-yl-1,3-diphenylpropylidene]amino]oxypentanoate (PubChem CID 10982669) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is ethyl 5-[(E)-[(2R)-2-imidazol-1-yl-1,3-diphenylpropylidene]amino]oxypentanoate.
| Compound Name | ethyl 5-[(E)-[(2R)-2-imidazol-1-yl-1,3-diphenylpropylidene]amino]oxypentanoate |
|---|---|
| PubChem CID | 10982669 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | ethyl 5-[(E)-[(2R)-2-imidazol-1-yl-1,3-diphenylpropylidene]amino]oxypentanoate |
| SMILES | CCOC(=O)CCCCO/N=C(\c1ccccc1)[C@@H](Cc1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C25H29N3O3/c1-2-30-24(29)15-9-10-18-31-27-25(22-13-7-4-8-14-22)23(28-17-16-26-20-28)19-21-11-5-3-6-12-21/h3-8,11-14,16-17,20,23H,2,9-10,15,18-19H2,1H3/b27-25+/t23-/m1/s1 |
| InChIKey | YJXPXGGMHOUHKH-BYWRHQNTSA-N |
| XLogP | 4.82 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|