C21H27N3O3 — CID 54482720
ethyl 5-[(2-methyl-1,2-dipyridin-3-ylpropylidene)amino]oxypentanoate (PubChem CID 54482720) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is ethyl 5-[(2-methyl-1,2-dipyridin-3-ylpropylidene)amino]oxypentanoate.
| Compound Name | ethyl 5-[(2-methyl-1,2-dipyridin-3-ylpropylidene)amino]oxypentanoate |
|---|---|
| PubChem CID | 54482720 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | ethyl 5-[(2-methyl-1,2-dipyridin-3-ylpropylidene)amino]oxypentanoate |
| SMILES | CCOC(=O)CCCCON=C(c1cccnc1)C(C)(C)c1cccnc1 |
| InChI | InChI=1S/C21H27N3O3/c1-4-26-19(25)11-5-6-14-27-24-20(17-9-7-12-22-15-17)21(2,3)18-10-8-13-23-16-18/h7-10,12-13,15-16H,4-6,11,14H2,1-3H3 |
| InChIKey | XQDSMUXWRRJLIL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 73.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|