C21H26N4O3 — CID 10362488
3-(cyclobutylmethoxy)-4-[[N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]benzamide (PubChem CID 10362488) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 3-(cyclobutylmethoxy)-4-[[N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]benzamide.
| Compound Name | 3-(cyclobutylmethoxy)-4-[[N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]benzamide |
|---|---|
| PubChem CID | 10362488 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3-(cyclobutylmethoxy)-4-[[N'-[(2-methoxyphenyl)methyl]carbamimidoyl]amino]benzamide |
| SMILES | COc1ccccc1C/N=C(\N)Nc1ccc(C(N)=O)cc1OCC1CCC1 |
| InChI | InChI=1S/C21H26N4O3/c1-27-18-8-3-2-7-16(18)12-24-21(23)25-17-10-9-15(20(22)26)11-19(17)28-13-14-5-4-6-14/h2-3,7-11,14H,4-6,12-13H2,1H3,(H2,22,26)(H3,23,24,25) |
| InChIKey | YAAOHBWGHAITBQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|