C31H38N4O3 — CID 67215316
4-[[N-(cyclohexylmethyl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-3-(1-phenoxyethoxy)benzamide (PubChem CID 67215316) has the molecular formula C31H38N4O3 and a molecular weight of 514.67 g/mol. Its IUPAC name is 4-[[N-(cyclohexylmethyl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-3-(1-phenoxyethoxy)benzamide.
| Compound Name | 4-[[N-(cyclohexylmethyl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-3-(1-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 67215316 |
| Molecular Formula | C31H38N4O3 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | 4-[[N-(cyclohexylmethyl)-N'-[(2-methylphenyl)methyl]carbamimidoyl]amino]-3-(1-phenoxyethoxy)benzamide |
| SMILES | Cc1ccccc1C/N=C(\NCC1CCCCC1)Nc1ccc(C(N)=O)cc1OC(C)Oc1ccccc1 |
| InChI | InChI=1S/C31H38N4O3/c1-22-11-9-10-14-26(22)21-34-31(33-20-24-12-5-3-6-13-24)35-28-18-17-25(30(32)36)19-29(28)38-23(2)37-27-15-7-4-8-16-27/h4,7-11,14-19,23-24H,3,5-6,12-13,20-21H2,1-2H3,(H2,32,36)(H2,33,34,35) |
| InChIKey | JYXNFIQDFKUNHC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|