C7H13F3N2OS — CID 103630060
2-amino-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide (PubChem CID 103630060) has the molecular formula C7H13F3N2OS and a molecular weight of 230.25 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide.
| Compound Name | 2-amino-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 103630060 |
| Molecular Formula | C7H13F3N2OS |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-amino-2-methyl-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
| SMILES | CC(C)(N)C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2OS/c1-6(2,11)5(13)12-3-4-14-7(8,9)10/h3-4,11H2,1-2H3,(H,12,13) |
| InChIKey | QVPPMTNCJGJQRH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|