C24H26N2O4 — CID 10363975
4-(7,7,10,10-tetramethyl-2,5-dioxo-1,3,8,9-tetrahydrobenzo[h][1,4]benzodiazepin-4-yl)benzoic acid (PubChem CID 10363975) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 4-(7,7,10,10-tetramethyl-2,5-dioxo-1,3,8,9-tetrahydrobenzo[h][1,4]benzodiazepin-4-yl)benzoic acid.
| Compound Name | 4-(7,7,10,10-tetramethyl-2,5-dioxo-1,3,8,9-tetrahydrobenzo[h][1,4]benzodiazepin-4-yl)benzoic acid |
|---|---|
| PubChem CID | 10363975 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 4-(7,7,10,10-tetramethyl-2,5-dioxo-1,3,8,9-tetrahydrobenzo[h][1,4]benzodiazepin-4-yl)benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)NC(=O)CN(c1ccc(C(=O)O)cc1)C3=O |
| InChI | InChI=1S/C24H26N2O4/c1-23(2)9-10-24(3,4)18-12-19-16(11-17(18)23)21(28)26(13-20(27)25-19)15-7-5-14(6-8-15)22(29)30/h5-8,11-12H,9-10,13H2,1-4H3,(H,25,27)(H,29,30) |
| InChIKey | UATWOTZITSKHJI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |