C24H31N3OS — CID 10364177
N-[2-(1-benzylpiperidin-4-yl)ethyl-ethylcarbamothioyl]benzamide (PubChem CID 10364177) has the molecular formula C24H31N3OS and a molecular weight of 409.60 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethyl-ethylcarbamothioyl]benzamide.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethyl-ethylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 10364177 |
| Molecular Formula | C24H31N3OS |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethyl-ethylcarbamothioyl]benzamide |
| SMILES | CCN(CCC1CCN(Cc2ccccc2)CC1)C(=S)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H31N3OS/c1-2-27(24(29)25-23(28)22-11-7-4-8-12-22)18-15-20-13-16-26(17-14-20)19-21-9-5-3-6-10-21/h3-12,20H,2,13-19H2,1H3,(H,25,28,29) |
| InChIKey | ZAELRSITUJZFDB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|