C27H30N2O2 — CID 10364473
4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl)benzoic acid (PubChem CID 10364473) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl)benzoic acid.
| Compound Name | 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 10364473 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indazol-3-yl)benzoic acid |
| SMILES | Cn1nc(-c2ccc(C(=O)O)cc2)c2c1-c1cc3c(cc1CC2)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C27H30N2O2/c1-26(2)12-13-27(3,4)22-15-20-18(14-21(22)26)10-11-19-23(28-29(5)24(19)20)16-6-8-17(9-7-16)25(30)31/h6-9,14-15H,10-13H2,1-5H3,(H,30,31) |
| InChIKey | FXNZTDNKRJZXNH-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |