C28H31NO2 — CID 10454432
4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid (PubChem CID 10454432) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid.
| Compound Name | 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 10454432 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-(1,7,7,10,10-pentamethyl-4,5,8,9-tetrahydronaphtho[2,3-g]indol-3-yl)benzoic acid |
| SMILES | Cn1cc(-c2ccc(C(=O)O)cc2)c2c1-c1cc3c(cc1CC2)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C28H31NO2/c1-27(2)12-13-28(3,4)24-15-21-19(14-23(24)27)10-11-20-22(16-29(5)25(20)21)17-6-8-18(9-7-17)26(30)31/h6-9,14-16H,10-13H2,1-5H3,(H,30,31) |
| InChIKey | JGRMLKMEVPQCNJ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |