C27H29NO2 — CID 10023879
4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydro-1H-naphtho[2,3-g]indol-3-yl)benzoic acid (PubChem CID 10023879) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydro-1H-naphtho[2,3-g]indol-3-yl)benzoic acid.
| Compound Name | 4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydro-1H-naphtho[2,3-g]indol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 10023879 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 4-(7,7,10,10-tetramethyl-4,5,8,9-tetrahydro-1H-naphtho[2,3-g]indol-3-yl)benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc3c(cc21)CCc1c(-c2ccc(C(=O)O)cc2)c[nH]c1-3 |
| InChI | InChI=1S/C27H29NO2/c1-26(2)11-12-27(3,4)23-14-20-18(13-22(23)26)9-10-19-21(15-28-24(19)20)16-5-7-17(8-6-16)25(29)30/h5-8,13-15,28H,9-12H2,1-4H3,(H,29,30) |
| InChIKey | OEBNMIZRNBUCMA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |