C14H17N3O — CID 103647920
(E)-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylprop-2-en-1-amine (PubChem CID 103647920) has the molecular formula C14H17N3O and a molecular weight of 243.31 g/mol. Its IUPAC name is (E)-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylprop-2-en-1-amine.
| Compound Name | (E)-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylprop-2-en-1-amine |
|---|---|
| PubChem CID | 103647920 |
| Molecular Formula | C14H17N3O |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (E)-N-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-phenylprop-2-en-1-amine |
| SMILES | Cc1noc(CCNC/C=C/c2ccccc2)n1 |
| InChI | InChI=1S/C14H17N3O/c1-12-16-14(18-17-12)9-11-15-10-5-8-13-6-3-2-4-7-13/h2-8,15H,9-11H2,1H3/b8-5+ |
| InChIKey | JEKBLHQGROKBNN-VMPITWQZSA-N |
| XLogP | 2.22 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|