C18H21F3N4O — CID 10365131
1-[6-(3-pyridin-3-ylpropoxy)-5-(trifluoromethyl)-2-pyridinyl]piperazine (PubChem CID 10365131) has the molecular formula C18H21F3N4O and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-[6-(3-pyridin-3-ylpropoxy)-5-(trifluoromethyl)-2-pyridinyl]piperazine.
| Compound Name | 1-[6-(3-pyridin-3-ylpropoxy)-5-(trifluoromethyl)-2-pyridinyl]piperazine |
|---|---|
| PubChem CID | 10365131 |
| Molecular Formula | C18H21F3N4O |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[6-(3-pyridin-3-ylpropoxy)-5-(trifluoromethyl)-2-pyridinyl]piperazine |
| SMILES | FC(F)(F)c1ccc(N2CCNCC2)nc1OCCCc1cccnc1 |
| InChI | InChI=1S/C18H21F3N4O/c19-18(20,21)15-5-6-16(25-10-8-22-9-11-25)24-17(15)26-12-2-4-14-3-1-7-23-13-14/h1,3,5-7,13,22H,2,4,8-12H2 |
| InChIKey | GJZATGDNYDSWNH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|