C21H18N4OS3 — CID 10365875
1-(4-oxo-2-thiophen-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-3-phenylthiourea (PubChem CID 10365875) has the molecular formula C21H18N4OS3 and a molecular weight of 438.60 g/mol. Its IUPAC name is 1-(4-oxo-2-thiophen-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-3-phenylthiourea.
| Compound Name | 1-(4-oxo-2-thiophen-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-3-phenylthiourea |
|---|---|
| PubChem CID | 10365875 |
| Molecular Formula | C21H18N4OS3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 1-(4-oxo-2-thiophen-2-yl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)-3-phenylthiourea |
| SMILES | O=c1c2c3c(sc2nc(-c2cccs2)n1NC(=S)Nc1ccccc1)CCCC3 |
| InChI | InChI=1S/C21H18N4OS3/c26-20-17-14-9-4-5-10-15(14)29-19(17)23-18(16-11-6-12-28-16)25(20)24-21(27)22-13-7-2-1-3-8-13/h1-3,6-8,11-12H,4-5,9-10H2,(H2,22,24,27) |
| InChIKey | KOYKXFBOBKSHFB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|