C12H17NO12S — CID 10366106
(2R,3R,4S)-3,4-dihydroxy-2-[[(3R,4S)-3-hydroxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 10366106) has the molecular formula C12H17NO12S and a molecular weight of 399.33 g/mol. Its IUPAC name is (2R,3R,4S)-3,4-dihydroxy-2-[[(3R,4S)-3-hydroxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4S)-3,4-dihydroxy-2-[[(3R,4S)-3-hydroxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 10366106 |
| Molecular Formula | C12H17NO12S |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | (2R,3R,4S)-3,4-dihydroxy-2-[[(3R,4S)-3-hydroxy-4-(sulfoamino)-6,8-dioxabicyclo[3.2.1]octan-2-yl]oxy]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=C[C@H](O)[C@@H](O)[C@H](OC2C3COC(O3)[C@@H](NS(=O)(=O)O)[C@H]2O)O1 |
| InChI | InChI=1S/C12H17NO12S/c14-3-1-4(10(17)18)23-12(7(3)15)25-9-5-2-22-11(24-5)6(8(9)16)13-26(19,20)21/h1,3,5-9,11-16H,2H2,(H,17,18)(H,19,20,21)/t3-,5?,6-,7+,8+,9?,11?,12-/m0/s1 |
| InChIKey | MHACPEWBPPIYGP-IQQXUKDLSA-N |
| XLogP | -3.70 |
| TPSA | 201.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | -3.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|