C11H17NO15S2 — CID 171122924
(2R,3R,4R)-2-[(3R,4R,5R,6S)-4,6-dihydroxy-5-(sulfoamino)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid (PubChem CID 171122924) has the molecular formula C11H17NO15S2 and a molecular weight of 467.38 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(3R,4R,5R,6S)-4,6-dihydroxy-5-(sulfoamino)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid.
| Compound Name | (2R,3R,4R)-2-[(3R,4R,5R,6S)-4,6-dihydroxy-5-(sulfoamino)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
|---|---|
| PubChem CID | 171122924 |
| Molecular Formula | C11H17NO15S2 |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | (2R,3R,4R)-2-[(3R,4R,5R,6S)-4,6-dihydroxy-5-(sulfoamino)oxan-3-yl]oxy-4-hydroxy-3-sulfooxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| SMILES | O=C(O)C1=C[C@@H](O)[C@@H](OS(=O)(=O)O)[C@H](O[C@@H]2CO[C@H](O)[C@H](NS(=O)(=O)O)[C@H]2O)O1 |
| InChI | InChI=1S/C11H17NO15S2/c13-3-1-4(9(15)16)25-11(8(3)27-29(21,22)23)26-5-2-24-10(17)6(7(5)14)12-28(18,19)20/h1,3,5-8,10-14,17H,2H2,(H,15,16)(H,18,19,20)(H,21,22,23)/t3-,5-,6-,7+,8-,10+,11+/m1/s1 |
| InChIKey | FTGJOLTTWVXHJF-ZBMKFBDZSA-N |
| XLogP | -4.28 |
| TPSA | 255.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | -4.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|