C9H12N4O — CID 103662448
N-(cyanomethyl)-N,1,3-trimethylpyrazole-4-carboxamide (PubChem CID 103662448) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is N-(cyanomethyl)-N,1,3-trimethylpyrazole-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N,1,3-trimethylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 103662448 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | N-(cyanomethyl)-N,1,3-trimethylpyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)N(C)CC#N |
| InChI | InChI=1S/C9H12N4O/c1-7-8(6-13(3)11-7)9(14)12(2)5-4-10/h6H,5H2,1-3H3 |
| InChIKey | KLBSGTUEBDCVHK-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|