C16H19NO11S2 — CID 10367218
[(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)oxan-2-yl]methyl acetate (PubChem CID 10367218) has the molecular formula C16H19NO11S2 and a molecular weight of 465.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10367218 |
| Molecular Formula | C16H19NO11S2 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4,6-triacetyloxy-5-(3,5-dioxo-1,2,4-dithiazolidin-4-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](n2c(=O)ssc2=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H19NO11S2/c1-6(18)24-5-10-12(25-7(2)19)13(26-8(3)20)11(14(28-10)27-9(4)21)17-15(22)29-30-16(17)23/h10-14H,5H2,1-4H3/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | WXAJFIMICVURNT-DHGKCCLASA-N |
| XLogP | -0.41 |
| TPSA | 153.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|