C16H25NO9 — CID 539114
[5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 539114) has the molecular formula C16H25NO9 and a molecular weight of 375.37 g/mol. Its IUPAC name is [5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 539114 |
| Molecular Formula | C16H25NO9 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [5-[acetyl(methyl)amino]-3,4-diacetyloxy-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1N(C)C(C)=O |
| InChI | InChI=1S/C16H25NO9/c1-8(18)17(5)13-15(25-11(4)21)14(24-10(3)20)12(7-23-9(2)19)26-16(13)22-6/h12-16H,7H2,1-6H3 |
| InChIKey | YHVKYAZUIGOUHQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|