C24H25FN4O4S — CID 10368053
1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-methoxyimino-2-thiophen-2-ylethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 10368053) has the molecular formula C24H25FN4O4S and a molecular weight of 484.55 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-methoxyimino-2-thiophen-2-ylethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-methoxyimino-2-thiophen-2-ylethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 10368053 |
| Molecular Formula | C24H25FN4O4S |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-7-[4-[(2E)-2-methoxyimino-2-thiophen-2-ylethyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | CO/N=C(\CN1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1)c1cccs1 |
| InChI | InChI=1S/C24H25FN4O4S/c1-33-26-19(22-3-2-10-34-22)14-27-6-8-28(9-7-27)21-12-20-16(11-18(21)25)23(30)17(24(31)32)13-29(20)15-4-5-15/h2-3,10-13,15H,4-9,14H2,1H3,(H,31,32)/b26-19+ |
| InChIKey | ZNKBJTORSGVEJU-LGUFXXKBSA-N |
| XLogP | 3.41 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|