C35H31FN4O6 — CID 24777863
1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-(2-oxochromen-3-yl)-2-phenylmethoxyiminoethyl]piperazin-1-yl]quinoline-3-carboxylic acid (PubChem CID 24777863) has the molecular formula C35H31FN4O6 and a molecular weight of 622.65 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-(2-oxochromen-3-yl)-2-phenylmethoxyiminoethyl]piperazin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-(2-oxochromen-3-yl)-2-phenylmethoxyiminoethyl]piperazin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 24777863 |
| Molecular Formula | C35H31FN4O6 |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-(2-oxochromen-3-yl)-2-phenylmethoxyiminoethyl]piperazin-1-yl]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCN(C/C(=N/OCc4ccccc4)c4cc5ccccc5oc4=O)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C35H31FN4O6/c36-28-17-26-30(40(24-10-11-24)19-27(33(26)41)34(42)43)18-31(28)39-14-12-38(13-15-39)20-29(37-45-21-22-6-2-1-3-7-22)25-16-23-8-4-5-9-32(23)46-35(25)44/h1-9,16-19,24H,10-15,20-21H2,(H,42,43)/b37-29- |
| InChIKey | MJBWMWTWERYCKZ-GPFIVKHLSA-N |
| XLogP | 5.02 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|