C29H28FN5O4S — CID 164622051
1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-phenylmethoxyimino-2-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]quinoline-3-carboxylic acid (PubChem CID 164622051) has the molecular formula C29H28FN5O4S and a molecular weight of 561.64 g/mol. Its IUPAC name is 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-phenylmethoxyimino-2-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]quinoline-3-carboxylic acid.
| Compound Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-phenylmethoxyimino-2-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 164622051 |
| Molecular Formula | C29H28FN5O4S |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 1-cyclopropyl-6-fluoro-4-oxo-7-[4-[(2E)-2-phenylmethoxyimino-2-(1,3-thiazol-2-yl)ethyl]piperazin-1-yl]quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1cn(C2CC2)c2cc(N3CCN(C/C(=N\OCc4ccccc4)c4nccs4)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C29H28FN5O4S/c30-23-14-21-25(35(20-6-7-20)16-22(27(21)36)29(37)38)15-26(23)34-11-9-33(10-12-34)17-24(28-31-8-13-40-28)32-39-18-19-4-2-1-3-5-19/h1-5,8,13-16,20H,6-7,9-12,17-18H2,(H,37,38)/b32-24+ |
| InChIKey | LPBKLDSFTRYLSC-FEZSWGLMSA-N |
| XLogP | 4.37 |
| TPSA | 100.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|