C29H29NO7 — CID 10368803
(E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2,6-dimethoxyphenyl)pent-2-ene-1,5-dione (PubChem CID 10368803) has the molecular formula C29H29NO7 and a molecular weight of 503.55 g/mol. Its IUPAC name is (E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2,6-dimethoxyphenyl)pent-2-ene-1,5-dione.
| Compound Name | (E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2,6-dimethoxyphenyl)pent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 10368803 |
| Molecular Formula | C29H29NO7 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | (E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2,6-dimethoxyphenyl)pent-2-ene-1,5-dione |
| SMILES | COc1cccc(OC)c1C(=O)/C=C/C(=C\N(O)Cc1ccccc1)C(=O)c1c(OC)cccc1OC |
| InChI | InChI=1S/C29H29NO7/c1-34-23-12-8-13-24(35-2)27(23)22(31)17-16-21(19-30(33)18-20-10-6-5-7-11-20)29(32)28-25(36-3)14-9-15-26(28)37-4/h5-17,19,33H,18H2,1-4H3/b17-16+,21-19+ |
| InChIKey | ZNVFPSPFUNTSBA-KAWJEVGISA-N |
| XLogP | 5.12 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|