C27H25NO3 — CID 10364309
(E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2-methylphenyl)pent-2-ene-1,5-dione (PubChem CID 10364309) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is (E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2-methylphenyl)pent-2-ene-1,5-dione.
| Compound Name | (E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2-methylphenyl)pent-2-ene-1,5-dione |
|---|---|
| PubChem CID | 10364309 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (E,4E)-4-[[benzyl(hydroxy)amino]methylidene]-1,5-bis(2-methylphenyl)pent-2-ene-1,5-dione |
| SMILES | Cc1ccccc1C(=O)/C=C/C(=C\N(O)Cc1ccccc1)C(=O)c1ccccc1C |
| InChI | InChI=1S/C27H25NO3/c1-20-10-6-8-14-24(20)26(29)17-16-23(27(30)25-15-9-7-11-21(25)2)19-28(31)18-22-12-4-3-5-13-22/h3-17,19,31H,18H2,1-2H3/b17-16+,23-19+ |
| InChIKey | HANRABQDKFXCDG-BNINBPOBSA-N |
| XLogP | 5.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|