C23H29NOSi — CID 176893365
N-benzyl-N-[(1Z,3E)-1-(2-methylphenyl)-4-trimethylsilylbuta-1,3-dienyl]acetamide (PubChem CID 176893365) has the molecular formula C23H29NOSi and a molecular weight of 363.58 g/mol. Its IUPAC name is N-benzyl-N-[(1Z,3E)-1-(2-methylphenyl)-4-trimethylsilylbuta-1,3-dienyl]acetamide.
| Compound Name | N-benzyl-N-[(1Z,3E)-1-(2-methylphenyl)-4-trimethylsilylbuta-1,3-dienyl]acetamide |
|---|---|
| PubChem CID | 176893365 |
| Molecular Formula | C23H29NOSi |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-benzyl-N-[(1Z,3E)-1-(2-methylphenyl)-4-trimethylsilylbuta-1,3-dienyl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)/C(=C\C=C\[Si](C)(C)C)c1ccccc1C |
| InChI | InChI=1S/C23H29NOSi/c1-19-12-9-10-15-22(19)23(16-11-17-26(3,4)5)24(20(2)25)18-21-13-7-6-8-14-21/h6-17H,18H2,1-5H3/b17-11+,23-16- |
| InChIKey | DRFGCXXAAURHKV-NFPDPDOOSA-N |
| XLogP | 5.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|