C24H36N4O4S2 — CID 10369020
4-methyl-N-[4-[4-[3-(propan-2-ylsulfonylamino)phenyl]piperazin-1-yl]butyl]benzenesulfonamide (PubChem CID 10369020) has the molecular formula C24H36N4O4S2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 4-methyl-N-[4-[4-[3-(propan-2-ylsulfonylamino)phenyl]piperazin-1-yl]butyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-[4-[3-(propan-2-ylsulfonylamino)phenyl]piperazin-1-yl]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10369020 |
| Molecular Formula | C24H36N4O4S2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 4-methyl-N-[4-[4-[3-(propan-2-ylsulfonylamino)phenyl]piperazin-1-yl]butyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCN2CCN(c3cccc(NS(=O)(=O)C(C)C)c3)CC2)cc1 |
| InChI | InChI=1S/C24H36N4O4S2/c1-20(2)33(29,30)26-22-7-6-8-23(19-22)28-17-15-27(16-18-28)14-5-4-13-25-34(31,32)24-11-9-21(3)10-12-24/h6-12,19-20,25-26H,4-5,13-18H2,1-3H3 |
| InChIKey | ZMFVNZUAHQQACM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|