C9H14F3NO2 — CID 103690636
2,2,2-trifluoro-N-[(3-hydroxycyclohexyl)methyl]acetamide (PubChem CID 103690636) has the molecular formula C9H14F3NO2 and a molecular weight of 225.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3-hydroxycyclohexyl)methyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(3-hydroxycyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 103690636 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3-hydroxycyclohexyl)methyl]acetamide |
| SMILES | O=C(NCC1CCCC(O)C1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO2/c10-9(11,12)8(15)13-5-6-2-1-3-7(14)4-6/h6-7,14H,1-5H2,(H,13,15) |
| InChIKey | ILZJIIPNUVRUTI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |