C30H33N3O5 — CID 10369254
benzyl N-[(2S)-1-[[(3S)-1-(benzylamino)-4-methyl-1,2-dioxopentan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 10369254) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(3S)-1-(benzylamino)-4-methyl-1,2-dioxopentan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(3S)-1-(benzylamino)-4-methyl-1,2-dioxopentan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10369254 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | benzyl N-[(2S)-1-[[(3S)-1-(benzylamino)-4-methyl-1,2-dioxopentan-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H33N3O5/c1-21(2)26(27(34)29(36)31-19-23-14-8-4-9-15-23)33-28(35)25(18-22-12-6-3-7-13-22)32-30(37)38-20-24-16-10-5-11-17-24/h3-17,21,25-26H,18-20H2,1-2H3,(H,31,36)(H,32,37)(H,33,35)/t25-,26-/m0/s1 |
| InChIKey | UOCVVIJHGZOZBB-UIOOFZCWSA-N |
| XLogP | 3.55 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|