C17H25IN2O2 — CID 103695645
tert-butyl N-[[2-(4-iodoanilino)cyclopentyl]methyl]carbamate (PubChem CID 103695645) has the molecular formula C17H25IN2O2 and a molecular weight of 416.30 g/mol. Its IUPAC name is tert-butyl N-[[2-(4-iodoanilino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(4-iodoanilino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 103695645 |
| Molecular Formula | C17H25IN2O2 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | tert-butyl N-[[2-(4-iodoanilino)cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1Nc1ccc(I)cc1 |
| InChI | InChI=1S/C17H25IN2O2/c1-17(2,3)22-16(21)19-11-12-5-4-6-15(12)20-14-9-7-13(18)8-10-14/h7-10,12,15,20H,4-6,11H2,1-3H3,(H,19,21) |
| InChIKey | NJFGOQKCBXNPCR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|