C18H27FN2O2 — CID 103695365
tert-butyl N-[[2-(4-fluoroanilino)cyclohexyl]methyl]carbamate (PubChem CID 103695365) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is tert-butyl N-[[2-(4-fluoroanilino)cyclohexyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(4-fluoroanilino)cyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 103695365 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | tert-butyl N-[[2-(4-fluoroanilino)cyclohexyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCCC1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H27FN2O2/c1-18(2,3)23-17(22)20-12-13-6-4-5-7-16(13)21-15-10-8-14(19)9-11-15/h8-11,13,16,21H,4-7,12H2,1-3H3,(H,20,22) |
| InChIKey | ORITVAVUNUPGIE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |