C17H24FIN2O2 — CID 103731044
tert-butyl N-[[2-(4-fluoro-2-iodoanilino)cyclopentyl]methyl]carbamate (PubChem CID 103731044) has the molecular formula C17H24FIN2O2 and a molecular weight of 434.29 g/mol. Its IUPAC name is tert-butyl N-[[2-(4-fluoro-2-iodoanilino)cyclopentyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-(4-fluoro-2-iodoanilino)cyclopentyl]methyl]carbamate |
|---|---|
| PubChem CID | 103731044 |
| Molecular Formula | C17H24FIN2O2 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | tert-butyl N-[[2-(4-fluoro-2-iodoanilino)cyclopentyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCC1Nc1ccc(F)cc1I |
| InChI | InChI=1S/C17H24FIN2O2/c1-17(2,3)23-16(22)20-10-11-5-4-6-14(11)21-15-8-7-12(18)9-13(15)19/h7-9,11,14,21H,4-6,10H2,1-3H3,(H,20,22) |
| InChIKey | MMDHQSZHQWWIBR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|